C19H30O5 — CID 140656557
dibutyl 2,4,4-trimethyl-6-oxocyclohexene-1,3-dicarboxylate (PubChem CID 140656557) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is dibutyl 2,4,4-trimethyl-6-oxocyclohexene-1,3-dicarboxylate.
| Compound Name | dibutyl 2,4,4-trimethyl-6-oxocyclohexene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 140656557 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | dibutyl 2,4,4-trimethyl-6-oxocyclohexene-1,3-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(C)C(C(=O)OCCCC)C(C)(C)CC1=O |
| InChI | InChI=1S/C19H30O5/c1-6-8-10-23-17(21)15-13(3)16(18(22)24-11-9-7-2)19(4,5)12-14(15)20/h16H,6-12H2,1-5H3 |
| InChIKey | OQNXTJCLPNBQCP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|