C17H15ClF3NW — CID 140656795
[2-chloro-6-(trifluoromethyl)phenyl]imino-(2-methyl-2-phenylpropylidene)tungsten (PubChem CID 140656795) has the molecular formula C17H15ClF3NW and a molecular weight of 509.60 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)phenyl]imino-(2-methyl-2-phenylpropylidene)tungsten.
| Compound Name | [2-chloro-6-(trifluoromethyl)phenyl]imino-(2-methyl-2-phenylpropylidene)tungsten |
|---|---|
| PubChem CID | 140656795 |
| Molecular Formula | C17H15ClF3NW |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)phenyl]imino-(2-methyl-2-phenylpropylidene)tungsten |
| SMILES | CC(C)(C=[W]=Nc1c(Cl)cccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H12.C7H3ClF3N.W/c1-10(2,3)9-7-5-4-6-8-9;8-5-3-1-2-4(6(5)12)7(9,10)11;/h1,4-8H,2-3H3;1-3H; |
| InChIKey | AGSNKJXCJSMEHO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |