C6H10F3NO2 — CID 140657262
(4R)-5,5,5-trifluoro-4-hydroxy-2-methylpentanamide (PubChem CID 140657262) has the molecular formula C6H10F3NO2 and a molecular weight of 185.15 g/mol. Its IUPAC name is (4R)-5,5,5-trifluoro-4-hydroxy-2-methylpentanamide.
| Compound Name | (4R)-5,5,5-trifluoro-4-hydroxy-2-methylpentanamide |
|---|---|
| PubChem CID | 140657262 |
| Molecular Formula | C6H10F3NO2 |
| Molecular Weight | 185.15 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (4R)-5,5,5-trifluoro-4-hydroxy-2-methylpentanamide |
| SMILES | CC(C[C@@H](O)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C6H10F3NO2/c1-3(5(10)12)2-4(11)6(7,8)9/h3-4,11H,2H2,1H3,(H2,10,12)/t3?,4-/m1/s1 |
| InChIKey | BUHASUWRVVFECP-SRBOSORUSA-N |
| XLogP | 0.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |