About CID 140659618
CID 140659618 (PubChem CID 140659618) has the molecular formula C13H20NO
and a molecular weight of 206.31 g/mol.
Molecular Properties
| Compound Name | CID 140659618 |
| PubChem CID | 140659618 |
| Molecular Formula | C13H20NO |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | — |
| SMILES | [CH2]C(=O)CNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H20NO/c1-9(15)8-14-13-5-10-2-11(6-13)4-12(3-10)7-13/h10-12,14H,1-8H2 |
| InChIKey | HVBYOBXMHROZDL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 140659618 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140659618?
The IUPAC name of CID 140659618 (CID 140659618) is not available.
What is the SMILES notation for CID 140659618?
The canonical SMILES for CID 140659618 is [CH2]C(=O)CNC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of CID 140659618?
The InChIKey is HVBYOBXMHROZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20NO/c1-9(15)8-14-13-5-10-2-11(6-13)4-12(3-10)7-13/h10-12,14H,1-8H2.
What are the key properties of CID 140659618?
CID 140659618 has a molecular weight of 206.31 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140659618 is sourced from PubChem (CID 140659618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).