C18H11F4O3S2- — CID 140660536
4-(8-ethylnaphthalen-1-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140660536) has the molecular formula C18H11F4O3S2- and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-(8-ethylnaphthalen-1-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-(8-ethylnaphthalen-1-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140660536 |
| Molecular Formula | C18H11F4O3S2- |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 4-(8-ethylnaphthalen-1-yl)sulfanyl-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCc1cccc2cccc(Sc3c(F)c(F)c(S(=O)(=O)[O-])c(F)c3F)c12 |
| InChI | InChI=1S/C18H12F4O3S2/c1-2-9-5-3-6-10-7-4-8-11(12(9)10)26-17-13(19)15(21)18(27(23,24)25)16(22)14(17)20/h3-8H,2H2,1H3,(H,23,24,25)/p-1 |
| InChIKey | DVAOMPZCVBQAIP-UHFFFAOYSA-M |
| XLogP | 5.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|