C15H21FN2 — CID 140660880
(4R)-1-fluoro-5-(1H-indol-3-yl)-2,4-dimethylpentan-3-amine (PubChem CID 140660880) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is (4R)-1-fluoro-5-(1H-indol-3-yl)-2,4-dimethylpentan-3-amine.
| Compound Name | (4R)-1-fluoro-5-(1H-indol-3-yl)-2,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 140660880 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (4R)-1-fluoro-5-(1H-indol-3-yl)-2,4-dimethylpentan-3-amine |
| SMILES | CC(CF)C(N)[C@H](C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H21FN2/c1-10(15(17)11(2)8-16)7-12-9-18-14-6-4-3-5-13(12)14/h3-6,9-11,15,18H,7-8,17H2,1-2H3/t10-,11?,15?/m1/s1 |
| InChIKey | DTUSOBZOQTXMMK-RWWNRMGGSA-N |
| XLogP | 3.28 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |