C11H13F3N2O2 — CID 140664582
(2,3,4-trifluorophenyl) N-amino-N-tert-butylcarbamate (PubChem CID 140664582) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is (2,3,4-trifluorophenyl) N-amino-N-tert-butylcarbamate.
| Compound Name | (2,3,4-trifluorophenyl) N-amino-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140664582 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (2,3,4-trifluorophenyl) N-amino-N-tert-butylcarbamate |
| SMILES | CC(C)(C)N(N)C(=O)Oc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H13F3N2O2/c1-11(2,3)16(15)10(17)18-7-5-4-6(12)8(13)9(7)14/h4-5H,15H2,1-3H3 |
| InChIKey | GWCPVAADZWIAPS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|