C16H15N5O4 — CID 140671933
(1Z)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(3-nitroanilino)-2-oxoethanimidoyl isocyanide (PubChem CID 140671933) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is (1Z)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(3-nitroanilino)-2-oxoethanimidoyl isocyanide.
| Compound Name | (1Z)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(3-nitroanilino)-2-oxoethanimidoyl isocyanide |
|---|---|
| PubChem CID | 140671933 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (1Z)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(3-nitroanilino)-2-oxoethanimidoyl isocyanide |
| SMILES | [C-]#[N+]/C(=N\Nc1cccc([N+](=O)[O-])c1)C(=O)c1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C16H15N5O4/c1-16(2,3)13-9-12(20-25-13)14(22)15(17-4)19-18-10-6-5-7-11(8-10)21(23)24/h5-9,18H,1-3H3/b19-15- |
| InChIKey | VRMKWCJVCCRZJJ-CYVLTUHYSA-N |
| XLogP | 3.41 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|