C12H11N5O5 — CID 59139809
ethyl N-[(2E)-2-isocyano-2-[(3-nitrophenyl)hydrazinylidene]acetyl]carbamate (PubChem CID 59139809) has the molecular formula C12H11N5O5 and a molecular weight of 305.25 g/mol. Its IUPAC name is ethyl N-[(2E)-2-isocyano-2-[(3-nitrophenyl)hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[(2E)-2-isocyano-2-[(3-nitrophenyl)hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 59139809 |
| Molecular Formula | C12H11N5O5 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl N-[(2E)-2-isocyano-2-[(3-nitrophenyl)hydrazinylidene]acetyl]carbamate |
| SMILES | [C-]#[N+]/C(=N/Nc1cccc([N+](=O)[O-])c1)C(=O)NC(=O)OCC |
| InChI | InChI=1S/C12H11N5O5/c1-3-22-12(19)14-11(18)10(13-2)16-15-8-5-4-6-9(7-8)17(20)21/h4-7,15H,3H2,1H3,(H,14,18,19)/b16-10+ |
| InChIKey | SCTOBPDFAHEMHR-MHWRWJLKSA-N |
| XLogP | 1.51 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|