About ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate
ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate (PubChem CID 87843785) has the molecular formula C22H24N4O6
and a molecular weight of 440.46 g/mol. Its IUPAC name is ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate.
Molecular Properties
| Compound Name | ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate |
| PubChem CID | 87843785 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N\Nc1cccc([N+](=O)[O-])c1.CCOC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H13N3O4.C11H11NO2/c1-3-18-11(15)8(2)12-13-9-5-4-6-10(7-9)14(16)17;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h4-7,13H,3H2,1-2H3;3-7,12H,2H2,1H3/b12-8-; |
| InChIKey | DFPWDOYPPNGGSA-JCTPKUEWSA-N |
| XLogP | 4.29 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate?
The IUPAC name of ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate (CID 87843785) is ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate.
What is the SMILES notation for ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate?
The canonical SMILES for ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate is CCOC(=O)/C(C)=N\Nc1cccc([N+](=O)[O-])c1.CCOC(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate?
The InChIKey is DFPWDOYPPNGGSA-JCTPKUEWSA-N. The full InChI is InChI=1S/C11H13N3O4.C11H11NO2/c1-3-18-11(15)8(2)12-13-9-5-4-6-10(7-9)14(16)17;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h4-7,13H,3H2,1-2H3;3-7,12H,2H2,1H3/b12-8-;.
What are the key properties of ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate?
ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate has a molecular weight of 440.46 g/mol, XLogP of 4.29, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-indole-2-carboxylate;ethyl (2Z)-2-[(3-nitrophenyl)hydrazinylidene]propanoate is sourced from PubChem (CID 87843785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).