C17H12FN3O5 — CID 7466226
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7466226) has the molecular formula C17H12FN3O5 and a molecular weight of 357.30 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7466226 |
| Molecular Formula | C17H12FN3O5 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2[nH]1)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C17H12FN3O5/c18-12-6-5-11(21(24)25)8-14(12)20-16(22)9-26-17(23)15-7-10-3-1-2-4-13(10)19-15/h1-8,19H,9H2,(H,20,22) |
| InChIKey | TVHOYXXQJCUWRX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|