C15H16ClNO6S — CID 140681884
[5-(4-chlorophenyl)-5-(ethylsulfonylamino)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681884) has the molecular formula C15H16ClNO6S and a molecular weight of 373.81 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-5-(ethylsulfonylamino)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(4-chlorophenyl)-5-(ethylsulfonylamino)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681884 |
| Molecular Formula | C15H16ClNO6S |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | [5-(4-chlorophenyl)-5-(ethylsulfonylamino)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CCS(=O)(=O)NC1(c2ccc(Cl)cc2)OC(C)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C15H16ClNO6S/c1-4-24(20,21)17-15(11-5-7-12(16)8-6-11)14(19)13(9(2)23-15)22-10(3)18/h5-8,17H,4H2,1-3H3 |
| InChIKey | GLDUQGORZBPGTG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |