C17H14ClNO5S — CID 140681887
N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzenesulfonamide (PubChem CID 140681887) has the molecular formula C17H14ClNO5S and a molecular weight of 379.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzenesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 140681887 |
| Molecular Formula | C17H14ClNO5S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzenesulfonamide |
| SMILES | CC1=C(O)C(=O)C(NS(=O)(=O)c2ccccc2)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H14ClNO5S/c1-11-15(20)16(21)17(24-11,12-7-9-13(18)10-8-12)19-25(22,23)14-5-3-2-4-6-14/h2-10,19-20H,1H3 |
| InChIKey | YZVQZMDYPLSAOY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |