C19H16ClNO6S — CID 140681896
[5-(benzenesulfonamido)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681896) has the molecular formula C19H16ClNO6S and a molecular weight of 421.86 g/mol. Its IUPAC name is [5-(benzenesulfonamido)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(benzenesulfonamido)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681896 |
| Molecular Formula | C19H16ClNO6S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [5-(benzenesulfonamido)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)OC(NS(=O)(=O)c2ccccc2)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C19H16ClNO6S/c1-12-17(26-13(2)22)18(23)19(27-12,14-8-10-15(20)11-9-14)21-28(24,25)16-6-4-3-5-7-16/h3-11,21H,1-2H3 |
| InChIKey | BVDTYEBQADYBAC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |