C12H12ClNO5S — CID 140681901
N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]methanesulfonamide (PubChem CID 140681901) has the molecular formula C12H12ClNO5S and a molecular weight of 317.75 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]methanesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 140681901 |
| Molecular Formula | C12H12ClNO5S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]methanesulfonamide |
| SMILES | CC1=C(O)C(=O)C(NS(C)(=O)=O)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C12H12ClNO5S/c1-7-10(15)11(16)12(19-7,14-20(2,17)18)8-3-5-9(13)6-4-8/h3-6,14-15H,1-2H3 |
| InChIKey | MXLWBRXKKPRTPK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |