C14H14ClNO5 — CID 140681898
ethyl N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]carbamate (PubChem CID 140681898) has the molecular formula C14H14ClNO5 and a molecular weight of 311.72 g/mol. Its IUPAC name is ethyl N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]carbamate.
| Compound Name | ethyl N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]carbamate |
|---|---|
| PubChem CID | 140681898 |
| Molecular Formula | C14H14ClNO5 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | ethyl N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]carbamate |
| SMILES | CCOC(=O)NC1(c2ccc(Cl)cc2)OC(C)=C(O)C1=O |
| InChI | InChI=1S/C14H14ClNO5/c1-3-20-13(19)16-14(9-4-6-10(15)7-5-9)12(18)11(17)8(2)21-14/h4-7,17H,3H2,1-2H3,(H,16,19) |
| InChIKey | BOLVPFDQMPMJGS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |