C15H14ClNO5 — CID 140681885
[5-acetamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681885) has the molecular formula C15H14ClNO5 and a molecular weight of 323.73 g/mol. Its IUPAC name is [5-acetamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-acetamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681885 |
| Molecular Formula | C15H14ClNO5 |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [5-acetamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)NC1(c2ccc(Cl)cc2)OC(C)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C15H14ClNO5/c1-8-13(21-10(3)19)14(20)15(22-8,17-9(2)18)11-4-6-12(16)7-5-11/h4-7H,1-3H3,(H,17,18) |
| InChIKey | JLXCTFHKYAGGBL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |