C16H16ClNO6 — CID 140681888
[5-(4-chlorophenyl)-5-(ethoxycarbonylamino)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681888) has the molecular formula C16H16ClNO6 and a molecular weight of 353.76 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-5-(ethoxycarbonylamino)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(4-chlorophenyl)-5-(ethoxycarbonylamino)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681888 |
| Molecular Formula | C16H16ClNO6 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [5-(4-chlorophenyl)-5-(ethoxycarbonylamino)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CCOC(=O)NC1(c2ccc(Cl)cc2)OC(C)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C16H16ClNO6/c1-4-22-15(21)18-16(11-5-7-12(17)8-6-11)14(20)13(9(2)24-16)23-10(3)19/h5-8H,4H2,1-3H3,(H,18,21) |
| InChIKey | MLQNWBPBNFTNEK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |