C14H14ClNO6S — CID 140681889
[5-(4-chlorophenyl)-5-(methanesulfonamido)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681889) has the molecular formula C14H14ClNO6S and a molecular weight of 359.79 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-5-(methanesulfonamido)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(4-chlorophenyl)-5-(methanesulfonamido)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681889 |
| Molecular Formula | C14H14ClNO6S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | [5-(4-chlorophenyl)-5-(methanesulfonamido)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)OC(NS(C)(=O)=O)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C14H14ClNO6S/c1-8-12(21-9(2)17)13(18)14(22-8,16-23(3,19)20)10-4-6-11(15)7-5-10/h4-7,16H,1-3H3 |
| InChIKey | VXKRQMYKNMJQBR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |