C17H14ClNO6 — CID 140681897
[5-(4-chlorophenyl)-5-(2,5-dioxopyrrolidin-1-yl)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681897) has the molecular formula C17H14ClNO6 and a molecular weight of 363.75 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-5-(2,5-dioxopyrrolidin-1-yl)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(4-chlorophenyl)-5-(2,5-dioxopyrrolidin-1-yl)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681897 |
| Molecular Formula | C17H14ClNO6 |
| Molecular Weight | 363.75 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [5-(4-chlorophenyl)-5-(2,5-dioxopyrrolidin-1-yl)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)OC(c2ccc(Cl)cc2)(N2C(=O)CCC2=O)C1=O |
| InChI | InChI=1S/C17H14ClNO6/c1-9-15(24-10(2)20)16(23)17(25-9,11-3-5-12(18)6-4-11)19-13(21)7-8-14(19)22/h3-6H,7-8H2,1-2H3 |
| InChIKey | BQMZXPYBHLDBAX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|