C15H12ClNO5 — CID 140681900
1-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]pyrrolidine-2,5-dione (PubChem CID 140681900) has the molecular formula C15H12ClNO5 and a molecular weight of 321.72 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 140681900 |
| Molecular Formula | C15H12ClNO5 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]pyrrolidine-2,5-dione |
| SMILES | CC1=C(O)C(=O)C(c2ccc(Cl)cc2)(N2C(=O)CCC2=O)O1 |
| InChI | InChI=1S/C15H12ClNO5/c1-8-13(20)14(21)15(22-8,9-2-4-10(16)5-3-9)17-11(18)6-7-12(17)19/h2-5,20H,6-7H2,1H3 |
| InChIKey | WKKYOBCWECZTDH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|