C15H15BrClNO4 — CID 140681903
4-bromo-N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]butanamide (PubChem CID 140681903) has the molecular formula C15H15BrClNO4 and a molecular weight of 388.65 g/mol. Its IUPAC name is 4-bromo-N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]butanamide.
| Compound Name | 4-bromo-N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]butanamide |
|---|---|
| PubChem CID | 140681903 |
| Molecular Formula | C15H15BrClNO4 |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 4-bromo-N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]butanamide |
| SMILES | CC1=C(O)C(=O)C(NC(=O)CCCBr)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C15H15BrClNO4/c1-9-13(20)14(21)15(22-9,18-12(19)3-2-8-16)10-4-6-11(17)7-5-10/h4-7,20H,2-3,8H2,1H3,(H,18,19) |
| InChIKey | MSELIQOGZUVLNB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|