C17H17BrClNO5 — CID 140681902
[5-(4-bromobutanoylamino)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681902) has the molecular formula C17H17BrClNO5 and a molecular weight of 430.68 g/mol. Its IUPAC name is [5-(4-bromobutanoylamino)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-(4-bromobutanoylamino)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681902 |
| Molecular Formula | C17H17BrClNO5 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | [5-(4-bromobutanoylamino)-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)OC(NC(=O)CCCBr)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H17BrClNO5/c1-10-15(24-11(2)21)16(23)17(25-10,20-14(22)4-3-9-18)12-5-7-13(19)8-6-12/h5-8H,3-4,9H2,1-2H3,(H,20,22) |
| InChIKey | IODNPSBMNGVBBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|