C18H14ClNO4 — CID 140681886
N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzamide (PubChem CID 140681886) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzamide |
|---|---|
| PubChem CID | 140681886 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-hydroxy-5-methyl-3-oxofuran-2-yl]benzamide |
| SMILES | CC1=C(O)C(=O)C(NC(=O)c2ccccc2)(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C18H14ClNO4/c1-11-15(21)16(22)18(24-11,13-7-9-14(19)10-8-13)20-17(23)12-5-3-2-4-6-12/h2-10,21H,1H3,(H,20,23) |
| InChIKey | SKSYCAABPXVQGB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |