C17H16ClNO5 — CID 140681890
[5-(4-chlorophenyl)-2-methyl-4-oxo-5-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate (PubChem CID 140681890) has the molecular formula C17H16ClNO5 and a molecular weight of 349.77 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-2-methyl-4-oxo-5-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate.
| Compound Name | [5-(4-chlorophenyl)-2-methyl-4-oxo-5-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate |
|---|---|
| PubChem CID | 140681890 |
| Molecular Formula | C17H16ClNO5 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [5-(4-chlorophenyl)-2-methyl-4-oxo-5-(2-oxopyrrolidin-1-yl)furan-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)OC(c2ccc(Cl)cc2)(N2CCCC2=O)C1=O |
| InChI | InChI=1S/C17H16ClNO5/c1-10-15(23-11(2)20)16(22)17(24-10,19-9-3-4-14(19)21)12-5-7-13(18)8-6-12/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | FKAHCKNFVSERJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |