About S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate
S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate (PubChem CID 140681975) has the molecular formula C6H5NOS3
and a molecular weight of 203.31 g/mol. Its IUPAC name is S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate.
Molecular Properties
| Compound Name | S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate |
| PubChem CID | 140681975 |
| Molecular Formula | C6H5NOS3 |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 202.95 |
| IUPAC Name | S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate |
| SMILES | O=C(SS)c1ccc[nH]c1=S |
| InChI | InChI=1S/C6H5NOS3/c8-6(11-10)4-2-1-3-7-5(4)9/h1-3,10H,(H,7,9) |
| InChIKey | OYWYEBWQZBRHBI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate?
The IUPAC name of S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate (CID 140681975) is S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate.
What is the SMILES notation for S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate?
The canonical SMILES for S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate is O=C(SS)c1ccc[nH]c1=S.
What is the InChIKey of S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate?
The InChIKey is OYWYEBWQZBRHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NOS3/c8-6(11-10)4-2-1-3-7-5(4)9/h1-3,10H,(H,7,9).
What are the key properties of S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate?
S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate has a molecular weight of 203.31 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-sulfanyl 2-sulfanylidene-1H-pyridine-3-carbothioate is sourced from PubChem (CID 140681975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).