About methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid
methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid (PubChem CID 87477516) has the molecular formula C7H9NOS3
and a molecular weight of 219.36 g/mol. Its IUPAC name is methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid.
Molecular Properties
| Compound Name | methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid |
| PubChem CID | 87477516 |
| Molecular Formula | C7H9NOS3 |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid |
| SMILES | CS.O=C(S)c1ccc[nH]c1=S |
| InChI | InChI=1S/C6H5NOS2.CH4S/c8-6(10)4-2-1-3-7-5(4)9;1-2/h1-3H,(H,7,9)(H,8,10);2H,1H3 |
| InChIKey | SBYVWIVJEIDLOW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid?
The IUPAC name of methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid (CID 87477516) is methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid.
What is the SMILES notation for methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid?
The canonical SMILES for methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid is CS.O=C(S)c1ccc[nH]c1=S.
What is the InChIKey of methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid?
The InChIKey is SBYVWIVJEIDLOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NOS2.CH4S/c8-6(10)4-2-1-3-7-5(4)9;1-2/h1-3H,(H,7,9)(H,8,10);2H,1H3.
What are the key properties of methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid?
methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid has a molecular weight of 219.36 g/mol, XLogP of 2.36, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;2-sulfanylidene-1H-pyridine-3-carbothioic S-acid is sourced from PubChem (CID 87477516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).