C21H35N5O2 — CID 140684631
[(3S)-7-(5-aminopiperazin-2-yl)-4-(cyclopropanecarbonyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-cyclopropylmethanone (PubChem CID 140684631) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [(3S)-7-(5-aminopiperazin-2-yl)-4-(cyclopropanecarbonyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-cyclopropylmethanone.
| Compound Name | [(3S)-7-(5-aminopiperazin-2-yl)-4-(cyclopropanecarbonyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 140684631 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | [(3S)-7-(5-aminopiperazin-2-yl)-4-(cyclopropanecarbonyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-cyclopropylmethanone |
| SMILES | C[C@H]1CN(C(=O)C2CC2)C2CC(C3CNC(N)CN3)CCC2N1C(=O)C1CC1 |
| InChI | InChI=1S/C21H35N5O2/c1-12-11-25(20(27)13-2-3-13)18-8-15(16-9-24-19(22)10-23-16)6-7-17(18)26(12)21(28)14-4-5-14/h12-19,23-24H,2-11,22H2,1H3/t12-,15?,16?,17?,18?,19?/m0/s1 |
| InChIKey | XXQKJIUIGSGUMO-ZSHGBNQVSA-N |
| XLogP | 0.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |