C27H25F3N2O3 — CID 140688620
[2-(benzylcarbamoyl)-5-[2-[(2-methylphenyl)methylamino]cyclopropyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 140688620) has the molecular formula C27H25F3N2O3 and a molecular weight of 482.50 g/mol. Its IUPAC name is [2-(benzylcarbamoyl)-5-[2-[(2-methylphenyl)methylamino]cyclopropyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(benzylcarbamoyl)-5-[2-[(2-methylphenyl)methylamino]cyclopropyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140688620 |
| Molecular Formula | C27H25F3N2O3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | [2-(benzylcarbamoyl)-5-[2-[(2-methylphenyl)methylamino]cyclopropyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccccc1CNC1CC1c1ccc(C(=O)NCc2ccccc2)c(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H25F3N2O3/c1-17-7-5-6-10-20(17)16-31-23-14-22(23)19-11-12-21(24(13-19)35-26(34)27(28,29)30)25(33)32-15-18-8-3-2-4-9-18/h2-13,22-23,31H,14-16H2,1H3,(H,32,33) |
| InChIKey | SSOZXOPLWGLHSN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|