C19H21F2N5O2S — CID 140688936
N-(2,6-difluorophenyl)-4-[5-(N-hydroxy-C-methylcarbonimidoyl)-2-methylsulfanylpyrimidin-4-yl]piperidine-1-carboxamide (PubChem CID 140688936) has the molecular formula C19H21F2N5O2S and a molecular weight of 421.47 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-[5-(N-hydroxy-C-methylcarbonimidoyl)-2-methylsulfanylpyrimidin-4-yl]piperidine-1-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-4-[5-(N-hydroxy-C-methylcarbonimidoyl)-2-methylsulfanylpyrimidin-4-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 140688936 |
| Molecular Formula | C19H21F2N5O2S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-[5-(N-hydroxy-C-methylcarbonimidoyl)-2-methylsulfanylpyrimidin-4-yl]piperidine-1-carboxamide |
| SMILES | CSc1ncc(C(C)=NO)c(C2CCN(C(=O)Nc3c(F)cccc3F)CC2)n1 |
| InChI | InChI=1S/C19H21F2N5O2S/c1-11(25-28)13-10-22-18(29-2)23-16(13)12-6-8-26(9-7-12)19(27)24-17-14(20)4-3-5-15(17)21/h3-5,10,12,28H,6-9H2,1-2H3,(H,24,27) |
| InChIKey | HSFJZRKGINYAQY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|