About bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate
bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate (PubChem CID 140689647) has the molecular formula C30H51AlO9
and a molecular weight of 582.71 g/mol. Its IUPAC name is bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate.
Molecular Properties
| Compound Name | bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate |
| PubChem CID | 140689647 |
| Molecular Formula | C30H51AlO9 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate |
| SMILES | CCCCCCCC(=O)CC(=O)O[Al](OC(=O)CC(=O)CCCCCCC)OC(=O)CC(=O)CCCCCCC |
| InChI | InChI=1S/3C10H18O3.Al/c3*1-2-3-4-5-6-7-9(11)8-10(12)13;/h3*2-8H2,1H3,(H,12,13);/q;;;+3/p-3 |
| InChIKey | BIEGWZQTUUBSQO-UHFFFAOYSA-K |
| XLogP | 6.56 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate?
The IUPAC name of bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate (CID 140689647) is bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate.
What is the SMILES notation for bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate?
The canonical SMILES for bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate is CCCCCCCC(=O)CC(=O)O[Al](OC(=O)CC(=O)CCCCCCC)OC(=O)CC(=O)CCCCCCC.
What is the InChIKey of bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate?
The InChIKey is BIEGWZQTUUBSQO-UHFFFAOYSA-K. The full InChI is InChI=1S/3C10H18O3.Al/c3*1-2-3-4-5-6-7-9(11)8-10(12)13;/h3*2-8H2,1H3,(H,12,13);/q;;;+3/p-3.
What are the key properties of bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate?
bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate has a molecular weight of 582.71 g/mol, XLogP of 6.56, 27 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-oxodecanoyloxy)alumanyl 3-oxodecanoate is sourced from PubChem (CID 140689647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).