C26H22N6O2Pd — CID 140690606
6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-furo[3,2-d][1,3]oxazol-6-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine;palladium (PubChem CID 140690606) has the molecular formula C26H22N6O2Pd and a molecular weight of 556.92 g/mol. Its IUPAC name is 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-furo[3,2-d][1,3]oxazol-6-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine;palladium.
| Compound Name | 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-furo[3,2-d][1,3]oxazol-6-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine;palladium |
|---|---|
| PubChem CID | 140690606 |
| Molecular Formula | C26H22N6O2Pd |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-furo[3,2-d][1,3]oxazol-6-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine;palladium |
| SMILES | Cn1cc(-c2cccc(N(C/N=C/c3coc4ocnc34)c3ccccc3)n2)c2[cH-]c[n+](C)c21.[Pd] |
| InChI | InChI=1S/C26H22N6O2.Pd/c1-30-12-11-20-21(14-31(2)25(20)30)22-9-6-10-23(29-22)32(19-7-4-3-5-8-19)16-27-13-18-15-33-26-24(18)28-17-34-26;/h3-15,17H,16H2,1-2H3;/b27-13+; |
| InChIKey | LNCYMIXOIAEIAS-LPUIDCEHSA-N |
| XLogP | 4.73 |
| TPSA | 76.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|