C27H22N5O2Zn+ — CID 156678471
zinc 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-3H-furo[2,3-b]furan-3-id-4-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine (PubChem CID 156678471) has the molecular formula C27H22N5O2Zn+ and a molecular weight of 513.90 g/mol. Its IUPAC name is zinc 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-3H-furo[2,3-b]furan-3-id-4-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine.
| Compound Name | zinc 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-3H-furo[2,3-b]furan-3-id-4-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 156678471 |
| Molecular Formula | C27H22N5O2Zn+ |
| Molecular Weight | 513.90 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | zinc 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-3H-furo[2,3-b]furan-3-id-4-ylmethylideneamino]methyl]-N-phenylpyridin-2-amine |
| SMILES | Cn1cc(-c2cccc(N(C/N=C/c3coc4oc[c-]c34)c3ccccc3)n2)c2[cH-]c[n+](C)c21.[Zn+2] |
| InChI | InChI=1S/C27H22N5O2.Zn/c1-30-13-11-22-23(16-31(2)26(22)30)24-9-6-10-25(29-24)32(20-7-4-3-5-8-20)18-28-15-19-17-34-27-21(19)12-14-33-27;/h3-11,13-17H,18H2,1-2H3;/q-1;+2/b28-15+; |
| InChIKey | AEWKAKCJYDYCSV-JVIVJJPTSA-N |
| XLogP | 5.14 |
| TPSA | 63.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|