C28H23MnN4O2+ — CID 162457837
N-[2-[6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-2-pyridinyl]-2-phenylethyl]-1-(3H-furo[2,3-b]furan-3-id-4-yl)methanimine;manganese(2+) (PubChem CID 162457837) has the molecular formula C28H23MnN4O2+ and a molecular weight of 502.46 g/mol. Its IUPAC name is N-[2-[6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-2-pyridinyl]-2-phenylethyl]-1-(3H-furo[2,3-b]furan-3-id-4-yl)methanimine;manganese(2+).
| Compound Name | N-[2-[6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-2-pyridinyl]-2-phenylethyl]-1-(3H-furo[2,3-b]furan-3-id-4-yl)methanimine;manganese(2+) |
|---|---|
| PubChem CID | 162457837 |
| Molecular Formula | C28H23MnN4O2+ |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-[2-[6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-2-pyridinyl]-2-phenylethyl]-1-(3H-furo[2,3-b]furan-3-id-4-yl)methanimine;manganese(2+) |
| SMILES | Cn1cc(-c2cccc(C(C/N=C/c3coc4oc[c-]c34)c3ccccc3)n2)c2[cH-]c[n+](C)c21.[Mn+2] |
| InChI | InChI=1S/C28H23N4O2.Mn/c1-31-13-11-22-24(17-32(2)27(22)31)26-10-6-9-25(30-26)23(19-7-4-3-5-8-19)16-29-15-20-18-34-28-21(20)12-14-33-28;/h3-11,13-15,17-18,23H,16H2,1-2H3;/q-1;+2/b29-15+; |
| InChIKey | SKJCMMQZDKUZPT-GZPZNDDGSA-N |
| XLogP | 5.17 |
| TPSA | 60.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|