C32H18N4ORh — CID 162457786
2-(2H-indol-2-id-1-yl)-9-(3-pyridin-2-yl-4H-1-benzofuran-4-id-5-yl)pyrido[2,3-b]indole;rhodium(2+) (PubChem CID 162457786) has the molecular formula C32H18N4ORh and a molecular weight of 577.43 g/mol. Its IUPAC name is 2-(2H-indol-2-id-1-yl)-9-(3-pyridin-2-yl-4H-1-benzofuran-4-id-5-yl)pyrido[2,3-b]indole;rhodium(2+).
| Compound Name | 2-(2H-indol-2-id-1-yl)-9-(3-pyridin-2-yl-4H-1-benzofuran-4-id-5-yl)pyrido[2,3-b]indole;rhodium(2+) |
|---|---|
| PubChem CID | 162457786 |
| Molecular Formula | C32H18N4ORh |
| Molecular Weight | 577.43 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | 2-(2H-indol-2-id-1-yl)-9-(3-pyridin-2-yl-4H-1-benzofuran-4-id-5-yl)pyrido[2,3-b]indole;rhodium(2+) |
| SMILES | [Rh+2].[c-]1c(-n2c3ccccc3c3ccc(-n4[c-]cc5ccccc54)nc32)ccc2occ(-c3ccccn3)c12 |
| InChI | InChI=1S/C32H18N4O.Rh/c1-3-10-28-21(7-1)16-18-35(28)31-15-13-24-23-8-2-4-11-29(23)36(32(24)34-31)22-12-14-30-25(19-22)26(20-37-30)27-9-5-6-17-33-27;/h1-17,20H;/q-2;+2 |
| InChIKey | YWITWNUUYHHXKX-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.43 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|