C27H24N5O2Pt+ — CID 162457831
6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-(5-ethenoxyfuran-3-yl)methylideneamino]methyl]-N-phenylpyridin-2-amine;platinum(2+) (PubChem CID 162457831) has the molecular formula C27H24N5O2Pt+ and a molecular weight of 645.60 g/mol. Its IUPAC name is 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-(5-ethenoxyfuran-3-yl)methylideneamino]methyl]-N-phenylpyridin-2-amine;platinum(2+).
| Compound Name | 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-(5-ethenoxyfuran-3-yl)methylideneamino]methyl]-N-phenylpyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 162457831 |
| Molecular Formula | C27H24N5O2Pt+ |
| Molecular Weight | 645.60 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 6-(1,6-dimethyl-3H-pyrrolo[2,3-b]pyrrol-1-ium-3-id-4-yl)-N-[[(E)-(5-ethenoxyfuran-3-yl)methylideneamino]methyl]-N-phenylpyridin-2-amine;platinum(2+) |
| SMILES | [H]/[C-]=C/Oc1cc(/C=N\CN(c2ccccc2)c2cccc(-c3cn(C)c4c3[cH-]c[n+]4C)n2)co1.[Pt+2] |
| InChI | InChI=1S/C27H24N5O2.Pt/c1-4-33-26-15-20(18-34-26)16-28-19-32(21-9-6-5-7-10-21)25-12-8-11-24(29-25)23-17-31(3)27-22(23)13-14-30(27)2;/h1,4-18H,19H2,2-3H3;/q-1;+2/b28-16-; |
| InChIKey | MSGORMNRSJFYJA-JCDSVUNTSA-N |
| XLogP | 4.91 |
| TPSA | 59.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|