C26H22CuN6O2+2 — CID 162457741
copper 6-(3,4-dimethyl-6H-pyrrolo[2,3-d]imidazole-3,4-diium-1-id-6-yl)-N-(3-furo[3,2-d][1,3]oxazol-6-ylprop-2-enyl)-N-phenylpyridin-2-amine (PubChem CID 162457741) has the molecular formula C26H22CuN6O2+2 and a molecular weight of 514.05 g/mol. Its IUPAC name is copper 6-(3,4-dimethyl-6H-pyrrolo[2,3-d]imidazole-3,4-diium-1-id-6-yl)-N-(3-furo[3,2-d][1,3]oxazol-6-ylprop-2-enyl)-N-phenylpyridin-2-amine.
| Compound Name | copper 6-(3,4-dimethyl-6H-pyrrolo[2,3-d]imidazole-3,4-diium-1-id-6-yl)-N-(3-furo[3,2-d][1,3]oxazol-6-ylprop-2-enyl)-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 162457741 |
| Molecular Formula | C26H22CuN6O2+2 |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | copper 6-(3,4-dimethyl-6H-pyrrolo[2,3-d]imidazole-3,4-diium-1-id-6-yl)-N-(3-furo[3,2-d][1,3]oxazol-6-ylprop-2-enyl)-N-phenylpyridin-2-amine |
| SMILES | C[N+]1=CC(c2cccc(N(C/[C-]=C/c3coc4ocnc34)c3ccccc3)n2)c2[n-]c[n+](C)c21.[Cu+2] |
| InChI | InChI=1S/C26H22N6O2.Cu/c1-30-14-20(24-25(30)31(2)16-27-24)21-11-6-12-22(29-21)32(19-9-4-3-5-10-19)13-7-8-18-15-33-26-23(18)28-17-34-26;/h3-6,8-12,14-17,20H,13H2,1-2H3;/q;+2 |
| InChIKey | YNXQKEMVYKTIRQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|