C33H37O4S+ — CID 140692086
3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(6-propoxynaphthalen-2-yl)oxynaphthalen-1-yl]butan-1-one (PubChem CID 140692086) has the molecular formula C33H37O4S+ and a molecular weight of 529.72 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(6-propoxynaphthalen-2-yl)oxynaphthalen-1-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(6-propoxynaphthalen-2-yl)oxynaphthalen-1-yl]butan-1-one |
|---|---|
| PubChem CID | 140692086 |
| Molecular Formula | C33H37O4S+ |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(6-propoxynaphthalen-2-yl)oxynaphthalen-1-yl]butan-1-one |
| SMILES | CCCOc1ccc2cc(Oc3ccc(C(=O)C([S+]4CCOCC4)C(C)(C)C)c4ccccc34)ccc2c1 |
| InChI | InChI=1S/C33H37O4S/c1-5-16-36-25-12-10-24-22-26(13-11-23(24)21-25)37-30-15-14-29(27-8-6-7-9-28(27)30)31(34)32(33(2,3)4)38-19-17-35-18-20-38/h6-15,21-22,32H,5,16-20H2,1-4H3/q+1 |
| InChIKey | ZEXAEEIZWNLZBD-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|