C19H16N2O — CID 140692664
8-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 140692664) has the molecular formula C19H16N2O and a molecular weight of 295.39 g/mol. Its IUPAC name is 8-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 140692664 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 8-[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])C([2H])(c1ccnc(-c2cccc3c2oc2ncccc23)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H16N2O/c1-12(2)13-8-10-20-17(11-13)16-6-3-5-14-15-7-4-9-21-19(15)22-18(14)16/h3-12H,1-2H3/i1D3,2D3,12D |
| InChIKey | SFYZHJRFUAZFPQ-QLWPOVNFSA-N |
| XLogP | 5.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |