C27H21NO4 — CID 166573818
4-[6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzofuran-4-yl]benzenecarboperoxoic acid (PubChem CID 166573818) has the molecular formula C27H21NO4 and a molecular weight of 424.47 g/mol. Its IUPAC name is 4-[6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzofuran-4-yl]benzenecarboperoxoic acid.
| Compound Name | 4-[6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzofuran-4-yl]benzenecarboperoxoic acid |
|---|---|
| PubChem CID | 166573818 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-[6-[4-(2-deuteriopropan-2-yl)-2-pyridinyl]dibenzofuran-4-yl]benzenecarboperoxoic acid |
| SMILES | [2H]C(C)(C)c1ccnc(-c2cccc3c2oc2c(-c4ccc(C(=O)OO)cc4)cccc23)c1 |
| InChI | InChI=1S/C27H21NO4/c1-16(2)19-13-14-28-24(15-19)23-8-4-7-22-21-6-3-5-20(25(21)31-26(22)23)17-9-11-18(12-10-17)27(29)32-30/h3-16,30H,1-2H3/i16D |
| InChIKey | ZIAOIUMOLDIPKO-QNLPYAOMSA-N |
| XLogP | 7.07 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|