C29H25NO4 — CID 166578902
4-[6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]dibenzofuran-2-yl]benzenecarboperoxoic acid (PubChem CID 166578902) has the molecular formula C29H25NO4 and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-[6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]dibenzofuran-2-yl]benzenecarboperoxoic acid.
| Compound Name | 4-[6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]dibenzofuran-2-yl]benzenecarboperoxoic acid |
|---|---|
| PubChem CID | 166578902 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-[6-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]dibenzofuran-2-yl]benzenecarboperoxoic acid |
| SMILES | [2H]C([2H])(c1ccnc(-c2cccc3c2oc2ccc(-c4ccc(C(=O)OO)cc4)cc23)c1)C(C)(C)C |
| InChI | InChI=1S/C29H25NO4/c1-29(2,3)17-18-13-14-30-25(15-18)23-6-4-5-22-24-16-21(11-12-26(24)33-27(22)23)19-7-9-20(10-8-19)28(31)34-32/h4-16,32H,17H2,1-3H3/i17D2 |
| InChIKey | BLLCUVHZPAQWJN-FBCWWBABSA-N |
| XLogP | 7.53 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|