About 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate
2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate (PubChem CID 140694513) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate |
| PubChem CID | 140694513 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate |
| SMILES | C=C(CN1CCCC1=O)C(=O)OCCO |
| InChI | InChI=1S/C10H15NO4/c1-8(10(14)15-6-5-12)7-11-4-2-3-9(11)13/h12H,1-7H2 |
| InChIKey | CCZIRPCWMMWNDQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate?
The IUPAC name of 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate (CID 140694513) is 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate.
What is the SMILES notation for 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate?
The canonical SMILES for 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate is C=C(CN1CCCC1=O)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate?
The InChIKey is CCZIRPCWMMWNDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c1-8(10(14)15-6-5-12)7-11-4-2-3-9(11)13/h12H,1-7H2.
What are the key properties of 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate?
2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate has a molecular weight of 213.23 g/mol, XLogP of -0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-[(2-oxopyrrolidin-1-yl)methyl]prop-2-enoate is sourced from PubChem (CID 140694513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).