C22H43NO5 — CID 140695065
(3R,4R,5S,6R)-3-[[(Z)-hexadec-9-enyl]amino]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 140695065) has the molecular formula C22H43NO5 and a molecular weight of 401.59 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-[[(Z)-hexadec-9-enyl]amino]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-3-[[(Z)-hexadec-9-enyl]amino]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 140695065 |
| Molecular Formula | C22H43NO5 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | (3R,4R,5S,6R)-3-[[(Z)-hexadec-9-enyl]amino]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCCCCC/C=C\CCCCCCCCN[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H43NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23-19-21(26)20(25)18(17-24)28-22(19)27/h7-8,18-27H,2-6,9-17H2,1H3/b8-7-/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | MFJMDSXXRGZSCR-XESOVRCQSA-N |
| XLogP | 2.63 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|