C11H11NO6S-2 — CID 140695291
5-(propylsulfonylamino)benzene-1,3-dicarboxylate (PubChem CID 140695291) has the molecular formula C11H11NO6S-2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-(propylsulfonylamino)benzene-1,3-dicarboxylate.
| Compound Name | 5-(propylsulfonylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 140695291 |
| Molecular Formula | C11H11NO6S-2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 5-(propylsulfonylamino)benzene-1,3-dicarboxylate |
| SMILES | CCCS(=O)(=O)Nc1cc(C(=O)[O-])cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C11H13NO6S/c1-2-3-19(17,18)12-9-5-7(10(13)14)4-8(6-9)11(15)16/h4-6,12H,2-3H2,1H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | FUFSKIDEDXKTQK-UHFFFAOYSA-L |
| XLogP | -1.43 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |