C17H26CaO5S — CID 140686054
calcium;benzene-1,3-dicarboxylate;hydroxy(tripropyl)-λ4-sulfane (PubChem CID 140686054) has the molecular formula C17H26CaO5S and a molecular weight of 382.54 g/mol. Its IUPAC name is calcium;benzene-1,3-dicarboxylate;hydroxy(tripropyl)-λ4-sulfane.
| Compound Name | calcium;benzene-1,3-dicarboxylate;hydroxy(tripropyl)-λ4-sulfane |
|---|---|
| PubChem CID | 140686054 |
| Molecular Formula | C17H26CaO5S |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | calcium;benzene-1,3-dicarboxylate;hydroxy(tripropyl)-λ4-sulfane |
| SMILES | CCCS(O)(CCC)CCC.O=C([O-])c1cccc(C(=O)[O-])c1.[Ca+2] |
| InChI | InChI=1S/C9H22OS.C8H6O4.Ca/c1-4-7-11(10,8-5-2)9-6-3;9-7(10)5-2-1-3-6(4-5)8(11)12;/h10H,4-9H2,1-3H3;1-4H,(H,9,10)(H,11,12);/q;;+2/p-2 |
| InChIKey | PMCOQWIEOJTZSV-UHFFFAOYSA-L |
| XLogP | 1.53 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |