About benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium)
benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) (PubChem CID 141320241) has the molecular formula C44H68N2O4
and a molecular weight of 689.04 g/mol. Its IUPAC name is benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium).
Molecular Properties
| Compound Name | benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) |
| PubChem CID | 141320241 |
| Molecular Formula | C44H68N2O4 |
| Molecular Weight | 689.04 g/mol |
| Exact Mass | 688.52 |
| IUPAC Name | benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)c1ccccc1.CCCC[N+](CCCC)(CCCC)c1ccccc1.O=C([O-])c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/2C18H32N.C8H6O4/c2*1-4-7-15-19(16-8-5-2,17-9-6-3)18-13-11-10-12-14-18;9-7(10)5-2-1-3-6(4-5)8(11)12/h2*10-14H,4-9,15-17H2,1-3H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | NRLZAPSICOWPSW-UHFFFAOYSA-L |
| XLogP | 9.20 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 689.04 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium)?
The IUPAC name of benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) (CID 141320241) is benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium).
What is the SMILES notation for benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium)?
The canonical SMILES for benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) is CCCC[N+](CCCC)(CCCC)c1ccccc1.CCCC[N+](CCCC)(CCCC)c1ccccc1.O=C([O-])c1cccc(C(=O)[O-])c1.
What is the InChIKey of benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium)?
The InChIKey is NRLZAPSICOWPSW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H32N.C8H6O4/c2*1-4-7-15-19(16-8-5-2,17-9-6-3)18-13-11-10-12-14-18;9-7(10)5-2-1-3-6(4-5)8(11)12/h2*10-14H,4-9,15-17H2,1-3H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2.
What are the key properties of benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium)?
benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) has a molecular weight of 689.04 g/mol, XLogP of 9.20, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) is sourced from PubChem (CID 141320241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).