C44H68N2O4 — CID 141320241
benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) (PubChem CID 141320241) has the molecular formula C44H68N2O4 and a molecular weight of 689.04 g/mol. Its IUPAC name is benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium).
| Compound Name | benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) |
|---|---|
| PubChem CID | 141320241 |
| Molecular Formula | C44H68N2O4 |
| Molecular Weight | 689.04 g/mol |
| Exact Mass | 688.52 |
| IUPAC Name | benzene-1,3-dicarboxylate;bis(tributyl(phenyl)azanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)c1ccccc1.CCCC[N+](CCCC)(CCCC)c1ccccc1.O=C([O-])c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/2C18H32N.C8H6O4/c2*1-4-7-15-19(16-8-5-2,17-9-6-3)18-13-11-10-12-14-18;9-7(10)5-2-1-3-6(4-5)8(11)12/h2*10-14H,4-9,15-17H2,1-3H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | NRLZAPSICOWPSW-UHFFFAOYSA-L |
| XLogP | 9.20 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.04 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|