C21H38N+ — CID 175018250
dibutyl-(4,4-dimethylpentyl)-phenylazanium (PubChem CID 175018250) has the molecular formula C21H38N+ and a molecular weight of 304.54 g/mol. Its IUPAC name is dibutyl-(4,4-dimethylpentyl)-phenylazanium.
| Compound Name | dibutyl-(4,4-dimethylpentyl)-phenylazanium |
|---|---|
| PubChem CID | 175018250 |
| Molecular Formula | C21H38N+ |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.30 |
| IUPAC Name | dibutyl-(4,4-dimethylpentyl)-phenylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H38N/c1-6-8-17-22(18-9-7-2,19-13-16-21(3,4)5)20-14-11-10-12-15-20/h10-12,14-15H,6-9,13,16-19H2,1-5H3/q+1 |
| InChIKey | XAZNKKHEZOFFFV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|