C30H45NO5Si — CID 140698051
tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-methoxypropoxy)pyrrolidine-1-carboxylate (PubChem CID 140698051) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-methoxypropoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-methoxypropoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140698051 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-methoxypropoxy)pyrrolidine-1-carboxylate |
| SMILES | COCCCO[C@@H]1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C30H45NO5Si/c1-29(2,3)36-28(32)31-22-25(34-20-14-19-33-7)21-24(31)23-35-37(30(4,5)6,26-15-10-8-11-16-26)27-17-12-9-13-18-27/h8-13,15-18,24-25H,14,19-23H2,1-7H3/t24-,25-/m1/s1 |
| InChIKey | AVIMRQWCIHOBRR-JWQCQUIFSA-N |
| XLogP | 4.99 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|