C31H35F2O3S+ — CID 140699203
[3-[2-(3-cyclohexylpentan-3-yloxy)-2-oxoethoxy]phenyl]-bis(4-fluorophenyl)sulfanium (PubChem CID 140699203) has the molecular formula C31H35F2O3S+ and a molecular weight of 525.68 g/mol. Its IUPAC name is [3-[2-(3-cyclohexylpentan-3-yloxy)-2-oxoethoxy]phenyl]-bis(4-fluorophenyl)sulfanium.
| Compound Name | [3-[2-(3-cyclohexylpentan-3-yloxy)-2-oxoethoxy]phenyl]-bis(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 140699203 |
| Molecular Formula | C31H35F2O3S+ |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [3-[2-(3-cyclohexylpentan-3-yloxy)-2-oxoethoxy]phenyl]-bis(4-fluorophenyl)sulfanium |
| SMILES | CCC(CC)(OC(=O)COc1cccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C31H35F2O3S/c1-3-31(4-2,23-9-6-5-7-10-23)36-30(34)22-35-26-11-8-12-29(21-26)37(27-17-13-24(32)14-18-27)28-19-15-25(33)16-20-28/h8,11-21,23H,3-7,9-10,22H2,1-2H3/q+1 |
| InChIKey | BTKDFCTVRFSSTK-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|