C16H18N7O2+ — CID 140704014
2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-d][1,4]benzoxazepin-4-ium-10-carboxamide (PubChem CID 140704014) has the molecular formula C16H18N7O2+ and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-d][1,4]benzoxazepin-4-ium-10-carboxamide.
| Compound Name | 2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-d][1,4]benzoxazepin-4-ium-10-carboxamide |
|---|---|
| PubChem CID | 140704014 |
| Molecular Formula | C16H18N7O2+ |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-(2-propan-2-yl-1,2,4-triazol-3-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-d][1,4]benzoxazepin-4-ium-10-carboxamide |
| SMILES | CC(C)n1ncnc1-n1c[n+]2c(n1)-c1cc(C(N)=O)ccc1OCC2 |
| InChI | InChI=1S/C16H17N7O2/c1-10(2)23-16(18-8-19-23)22-9-21-5-6-25-13-4-3-11(14(17)24)7-12(13)15(21)20-22/h3-4,7-10H,5-6H2,1-2H3,(H-,17,24)/p+1 |
| InChIKey | JXTUIIXJZCJPKZ-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|